* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IFT 1025 |
CAS: | 71420-35-4 |
English Synonyms: | IFT 1025 |
MDL Number.: | MFCD01939522 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CN(Cc1cc(cc(c1NC(=O)C2CCCCC2)Br)Br)C3CCCCC3.Cl |
InChi: | InChI=1S/C21H30Br2N2O.ClH/c1-25(18-10-6-3-7-11-18)14-16-12-17(22)13-19(23)20(16)24-21(26)15-8-4-2-5-9-15;/h12-13,15,18H,2-11,14H2,1H3,(H,24,26);1H |
InChiKey: | InChIKey=ZGPHPRPOHXPUFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.