* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ECHINOSPORIN |
CAS: | 79127-35-8 |
English Synonyms: | ECHINOSPORIN |
MDL Number.: | MFCD01939575 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1=C[C@@]2([C@H]3[C@@H]1[C@@H](OC(=C3)C(=O)N)OC2=O)O |
InChi: | InChI=1S/C10H9NO5/c11-7(12)6-3-5-4-1-2-10(5,14)9(13)16-8(4)15-6/h1-5,8,14H,(H2,11,12)/t4-,5-,8+,10+/m1/s1 |
InChiKey: | InChIKey=OXSZHYWOGQJUST-QIWXSCBISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.