* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOCARCIN |
| CAS: | 84573-33-1 |
| English Synonyms: | QUINOCARCIN |
| MDL Number.: | MFCD01939653 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | C[C@@]12Cc3cccc(c3[C@]4(N1[C@@H]([C@@H]5C[C@H]([C@H]2N5C)C(=O)O)OC4)C)OC |
| InChi: | InChI=1S/C20H26N2O4/c1-19-9-11-6-5-7-14(25-4)15(11)20(2)10-26-17(22(19)20)13-8-12(18(23)24)16(19)21(13)3/h5-7,12-13,16-17H,8-10H2,1-4H3,(H,23,24)/t12-,13+,16-,17-,19+,20+/m1/s1 |
| InChiKey: | InChIKey=OXRFEVHLAOHXCK-NBDFASIVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.