* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GENETICIN |
| CAS: | 49863-47-0 ;108321-42-2 |
| English Synonyms: | GENETICIN ; G418 ; GENTAMICIN |
| MDL Number.: | MFCD01939984 |
| H bond acceptor: | 14 |
| H bond donor: | 10 |
| Smile: | C[C@@H]([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](C[C@H]([C@@H]([C@H]2O)O[C@@H]3[C@@H]([C@H]([C@@](CO3)(C)O)NC)O)N)N)N)O)O)O |
| InChi: | InChI=1S/C20H40N4O10/c1-6(25)14-11(27)10(26)9(23)18(32-14)33-15-7(21)4-8(22)16(12(15)28)34-19-13(29)17(24-3)20(2,30)5-31-19/h6-19,24-30H,4-5,21-23H2,1-3H3/t6-,7-,8+,9+,10+,11-,12-,13+,14+,15+,16-,17+,18+,19+,20-/m0/s1 |
| InChiKey: | InChIKey=BRZYSWJRSDMWLG-KVXRWBJUSA-N |
|
|
| Melting Point: | 138~144℃ |
|
|
| Symbol: |
GHS08
|
| Signal word: | Danger |
| Hazard statements: | H317,H334 |
| Precautionary statements: | P261,P272,P280,P285,P302+P352,P304+P341,P321,P333+P313,P342+P311,P363,P501 |
| Safe Code: | S:22,24/25 |
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.