* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035776 |
| English Synonyms: | VITAS-BB TBB035776 |
| MDL Number.: | MFCD01988851 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCSCCOC(=O)C1=C(C)NC2=C(C1C1=CC3=C(C=C1)N(CC)C1=C3C=CC=C1)C(=O)CCC2 |
| InChi: | InChI=1S/C29H32N2O3S/c1-4-31-23-11-7-6-9-20(23)21-17-19(13-14-24(21)31)27-26(29(33)34-15-16-35-5-2)18(3)30-22-10-8-12-25(32)28(22)27/h6-7,9,11,13-14,17,27,30H,4-5,8,10,12,15-16H2,1-3H3 |
| InChiKey: | InChIKey=RKYFHYGIOFYIHC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.