* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035777 |
| English Synonyms: | VITAS-BB TBB035777 |
| MDL Number.: | MFCD01988852 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)C1=C(NC(=O)CC2=CC=C(OC)C=C2)SC(C(=O)NC2=CC(Cl)=C(C)C=C2)=C1C |
| InChi: | InChI=1S/C25H25ClN2O5S/c1-5-33-25(31)21-15(3)22(23(30)27-17-9-6-14(2)19(26)13-17)34-24(21)28-20(29)12-16-7-10-18(32-4)11-8-16/h6-11,13H,5,12H2,1-4H3,(H,27,30)(H,28,29) |
| InChiKey: | InChIKey=YLEOSDUZCFNDTL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.