* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB020874 |
| English Synonyms: | VITAS-BB TBB020874 |
| MDL Number.: | MFCD01993803 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COC1=CC=C(NC(=O)C2C3CCC(C3)C2C(O)=O)C(OC)=C1 |
| InChi: | InChI=1S/C17H21NO5/c1-22-11-5-6-12(13(8-11)23-2)18-16(19)14-9-3-4-10(7-9)15(14)17(20)21/h5-6,8-10,14-15H,3-4,7H2,1-2H3,(H,18,19)(H,20,21) |
| InChiKey: | InChIKey=IWHIYJSPCDXHFO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.