* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB017026 |
| English Synonyms: | VITAS-BB TBB017026 |
| MDL Number.: | MFCD01993874 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | OC1=CC=C(Cl)C=C1C(=O)N\N=C1\CCSC1 |
| InChi: | InChI=1S/C11H11ClN2O2S/c12-7-1-2-10(15)9(5-7)11(16)14-13-8-3-4-17-6-8/h1-2,5,15H,3-4,6H2,(H,14,16)/b13-8- |
| InChiKey: | InChIKey=MQRCYSCXVONNIK-JYRVWZFOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.