* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB016729 |
English Synonyms: | VITAS-BB TBB016729 |
MDL Number.: | MFCD02025972 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COCCOC(=O)C1=C(C)NC(=O)CC1C1=C(F)C=CC=C1Cl |
InChi: | InChI=1S/C16H17ClFNO4/c1-9-14(16(21)23-7-6-22-2)10(8-13(20)19-9)15-11(17)4-3-5-12(15)18/h3-5,10H,6-8H2,1-2H3,(H,19,20) |
InChiKey: | InChIKey=YBPXPSICTROIJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.