* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 11244695 |
English Synonyms: | EMOLECULES 11244695 |
MDL Number.: | MFCD02053339 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)C)OCC(CN2CCCCC2)O.Cl |
InChi: | InChI=1S/C16H25NO2.ClH/c1-13-6-7-16(14(2)10-13)19-12-15(18)11-17-8-4-3-5-9-17;/h6-7,10,15,18H,3-5,8-9,11-12H2,1-2H3;1H |
InChiKey: | InChIKey=FMJKKBDPMJWCCF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.