* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 42771144 |
English Synonyms: | EMOLECULES 42771144 |
MDL Number.: | MFCD02053364 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)C)OCC(CN2CCc3ccccc3C2)O.Cl |
InChi: | InChI=1S/C20H25NO2.ClH/c1-15-7-8-20(16(2)11-15)23-14-19(22)13-21-10-9-17-5-3-4-6-18(17)12-21;/h3-8,11,19,22H,9-10,12-14H2,1-2H3;1H |
InChiKey: | InChIKey=DJTRQSJNROZKMH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.