* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024385 |
English Synonyms: | VITAS-BB TBB024385 |
MDL Number.: | MFCD02053842 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | CCOC1=CC=C(C=C1)C1=NC2=C(C=CC=C2)C(=C1)C(=O)NCCCN1CCN(CCCNC(=O)C2=CC(=NC3=C2C=CC=C3)C2=CC=C(OCC)C=C2)CC1 |
InChi: | InChI=1S/C46H50N6O4/c1-3-55-35-19-15-33(16-20-35)43-31-39(37-11-5-7-13-41(37)49-43)45(53)47-23-9-25-51-27-29-52(30-28-51)26-10-24-48-46(54)40-32-44(50-42-14-8-6-12-38(40)42)34-17-21-36(22-18-34)56-4-2/h5-8,11-22,31-32H,3-4,9-10,23-30H2,1-2H3,(H,47,53)(H,48,54) |
InChiKey: | InChIKey=JJDOLYIBYXVIML-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.