* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB022786 |
English Synonyms: | VITAS-BB TBB022786 |
MDL Number.: | MFCD02054375 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | O=C(NCCNC(=O)C(SC1=CC=CC=C1)C1=CC=CC=C1)C(SC1=CC=CC=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C30H28N2O2S2/c33-29(27(23-13-5-1-6-14-23)35-25-17-9-3-10-18-25)31-21-22-32-30(34)28(24-15-7-2-8-16-24)36-26-19-11-4-12-20-26/h1-20,27-28H,21-22H2,(H,31,33)(H,32,34) |
InChiKey: | InChIKey=LTNNNRLEILUFPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.