* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB025036 |
English Synonyms: | VITAS-BB TBB025036 |
MDL Number.: | MFCD02054380 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | ClC1=CC=CC(Cl)=C1C(=O)NCC1=CC=C(CNC(=O)C2=C(Cl)C=CC=C2Cl)C=C1 |
InChi: | InChI=1S/C22H16Cl4N2O2/c23-15-3-1-4-16(24)19(15)21(29)27-11-13-7-9-14(10-8-13)12-28-22(30)20-17(25)5-2-6-18(20)26/h1-10H,11-12H2,(H,27,29)(H,28,30) |
InChiKey: | InChIKey=CWUNFSMUHPLICU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.