* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024702 |
English Synonyms: | VITAS-BB TBB024702 |
MDL Number.: | MFCD02054440 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC1=CC=C(\C=C\C(=O)NCCCN2CCN(CCCNC(=O)\C=C\C3=CC=C(C)C=C3)CC2)C=C1 |
InChi: | InChI=1S/C30H40N4O2/c1-25-5-9-27(10-6-25)13-15-29(35)31-17-3-19-33-21-23-34(24-22-33)20-4-18-32-30(36)16-14-28-11-7-26(2)8-12-28/h5-16H,3-4,17-24H2,1-2H3,(H,31,35)(H,32,36)/b15-13+,16-14+ |
InChiKey: | InChIKey=GCOPKPUYCKRHKU-WXUKJITCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.