* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021687 |
English Synonyms: | VITAS-BB TBB021687 |
MDL Number.: | MFCD02056263 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | COC1=CC=C(C=C1)C1=NNC=C1\C=N/NC(=O)C1=CC(=CC=C1)[N+]([O-])=O |
InChi: | InChI=1S/C18H15N5O4/c1-27-16-7-5-12(6-8-16)17-14(10-19-21-17)11-20-22-18(24)13-3-2-4-15(9-13)23(25)26/h2-11H,1H3,(H,19,21)(H,22,24)/b20-11- |
InChiKey: | InChIKey=ZLLDMIKHPWSQLQ-JAIQZWGSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.