* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020828 |
English Synonyms: | VITAS-BB TBB020828 |
MDL Number.: | MFCD02056360 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1=C(NC(=O)C2=C(Cl)C3=C(S2)C=C(Cl)C=C3)SC(C(=O)N(CC)CC)=C1C |
InChi: | InChI=1S/C22H22Cl2N2O4S2/c1-5-26(6-2)21(28)17-11(4)15(22(29)30-7-3)20(32-17)25-19(27)18-16(24)13-9-8-12(23)10-14(13)31-18/h8-10H,5-7H2,1-4H3,(H,25,27) |
InChiKey: | InChIKey=LFNNZLRTKZVRLP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.