* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB022009 |
English Synonyms: | VITAS-BB TBB022009 |
MDL Number.: | MFCD02056381 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCCCCCCCC(=O)N\N=C(/C)C1=CC=C(NC(=O)CCCC(O)=O)C=C1 |
InChi: | InChI=1S/C22H33N3O4/c1-3-4-5-6-7-8-10-21(27)25-24-17(2)18-13-15-19(16-14-18)23-20(26)11-9-12-22(28)29/h13-16H,3-12H2,1-2H3,(H,23,26)(H,25,27)(H,28,29)/b24-17+ |
InChiKey: | InChIKey=TXEJUVUXSRDJTH-JJIBRWJFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.