* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021999 |
English Synonyms: | VITAS-BB TBB021999 |
MDL Number.: | MFCD02056387 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCCCCCCCC(=O)N\N=C(/C)C1=CC=C(NC(=O)\C=C\C(O)=O)C=C1 |
InChi: | InChI=1S/C21H29N3O4/c1-3-4-5-6-7-8-9-20(26)24-23-16(2)17-10-12-18(13-11-17)22-19(25)14-15-21(27)28/h10-15H,3-9H2,1-2H3,(H,22,25)(H,24,26)(H,27,28)/b15-14+,23-16+ |
InChiKey: | InChIKey=VWHYBMITIZJLJQ-UBXUXYOSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.