* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021017 |
English Synonyms: | VITAS-BB TBB021017 |
MDL Number.: | MFCD02056403 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCOC1=CC=CC(=C1)C1=CC(C(=O)NC2=C(C(=O)OC)C3=C(CCC4=C3C=CC=C4)S2)=C2C=CC=CC2=N1 |
InChi: | InChI=1S/C32H26N2O4S/c1-3-38-21-11-8-10-20(17-21)26-18-24(23-13-6-7-14-25(23)33-26)30(35)34-31-29(32(36)37-2)28-22-12-5-4-9-19(22)15-16-27(28)39-31/h4-14,17-18H,3,15-16H2,1-2H3,(H,34,35) |
InChiKey: | InChIKey=ORPJWWBGPIJMMR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.