* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020927 |
English Synonyms: | VITAS-BB TBB020927 |
MDL Number.: | MFCD02056414 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCCCOC1=CC=C(\C=N\NC(=O)C2=CC=C(OC(F)(F)C(F)F)C=C2)C=C1OC |
InChi: | InChI=1S/C21H22F4N2O4/c1-3-4-11-30-17-10-5-14(12-18(17)29-2)13-26-27-19(28)15-6-8-16(9-7-15)31-21(24,25)20(22)23/h5-10,12-13,20H,3-4,11H2,1-2H3,(H,27,28)/b26-13+ |
InChiKey: | InChIKey=FEQJZFKTIRVLRG-LGJNPRDNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.