* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021208 |
English Synonyms: | VITAS-BB TBB021208 |
MDL Number.: | MFCD02056438 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCOC(=O)C1=C(NC(=O)C2=C3C=CC=CC3=NC(=C2)C2=CC=C(C=C2)C(C)(C)C)SC2=C1CCCC2 |
InChi: | InChI=1S/C32H34N2O3S/c1-5-18-37-31(36)28-23-11-7-9-13-27(23)38-30(28)34-29(35)24-19-26(33-25-12-8-6-10-22(24)25)20-14-16-21(17-15-20)32(2,3)4/h6,8,10,12,14-17,19H,5,7,9,11,13,18H2,1-4H3,(H,34,35) |
InChiKey: | InChIKey=LIEYFUHPEWWZMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.