* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020898 |
English Synonyms: | VITAS-BB TBB020898 |
MDL Number.: | MFCD02056501 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | FC(F)C(F)(F)OC1=CC=C(C=C1)C(=O)N\N=C\C1=C(Cl)C=C2OCOC2=C1 |
InChi: | InChI=1S/C17H11ClF4N2O4/c18-12-6-14-13(26-8-27-14)5-10(12)7-23-24-15(25)9-1-3-11(4-2-9)28-17(21,22)16(19)20/h1-7,16H,8H2,(H,24,25)/b23-7+ |
InChiKey: | InChIKey=RBQAIPHFQIEPON-HCGXMYGOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.