* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021993 |
English Synonyms: | VITAS-BB TBB021993 |
MDL Number.: | MFCD02056524 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | COC1=CC=C(C=C1)C1=NNC=C1\C=N/NC(=O)C1=CC(OC)=CC(OC)=C1 |
InChi: | InChI=1S/C20H20N4O4/c1-26-16-6-4-13(5-7-16)19-15(11-21-23-19)12-22-24-20(25)14-8-17(27-2)10-18(9-14)28-3/h4-12H,1-3H3,(H,21,23)(H,24,25)/b22-12- |
InChiKey: | InChIKey=GGKZIPAJAPQTHX-UUYOSTAYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.