* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021641 |
English Synonyms: | VITAS-BB TBB021641 |
MDL Number.: | MFCD02056563 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCOC1=CC=C(C=C1)C(=O)N\N=C/C1=CNN=C1C1=CC=C(OC)C=C1 |
InChi: | InChI=1S/C20H20N4O3/c1-3-27-18-10-6-15(7-11-18)20(25)24-22-13-16-12-21-23-19(16)14-4-8-17(26-2)9-5-14/h4-13H,3H2,1-2H3,(H,21,23)(H,24,25)/b22-13- |
InChiKey: | InChIKey=PSDWYMPZJFWGSE-XKZIYDEJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.