* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB016746 |
English Synonyms: | VITAS-BB TBB016746 |
MDL Number.: | MFCD02068210 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCOC(=O)C1=C(NC(=O)C2CC2)SC(C(=O)NC2=CC=CC=C2OC)=C1C |
InChi: | InChI=1S/C20H22N2O5S/c1-4-27-20(25)15-11(2)16(28-19(15)22-17(23)12-9-10-12)18(24)21-13-7-5-6-8-14(13)26-3/h5-8,12H,4,9-10H2,1-3H3,(H,21,24)(H,22,23) |
InChiKey: | InChIKey=FCMQVJDQNALOHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.