* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/6010138 |
English Synonyms: | ZERENEX E/6010138 |
MDL Number.: | MFCD02070669 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)c(=O)[nH]c(n2)SCC(=O)Nc3cccc4c3nsn4 |
InChi: | InChI=1S/C16H11N5O2S2/c22-13(17-11-6-3-7-12-14(11)21-25-20-12)8-24-16-18-10-5-2-1-4-9(10)15(23)19-16/h1-7H,8H2,(H,17,22)(H,18,19,23) |
InChiKey: | InChIKey=ZRGAIAXJDRIVEN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.