* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB018030 |
English Synonyms: | VITAS-BB TBB018030 |
MDL Number.: | MFCD02076356 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | COC1=C(O)C=CC(=C1)C(\C)=N/NC(=O)C1=C(C)OC=C1 |
InChi: | InChI=1S/C15H16N2O4/c1-9(11-4-5-13(18)14(8-11)20-3)16-17-15(19)12-6-7-21-10(12)2/h4-8,18H,1-3H3,(H,17,19)/b16-9- |
InChiKey: | InChIKey=CHHFBAQHWQSUHN-SXGWCWSVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.