* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 5640367 |
English Synonyms: | EMOLECULES 5640367 |
MDL Number.: | MFCD02078940 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(c3c(n2)CCC3)O |
InChi: | InChI=1S/C12H11NO/c14-12-8-4-1-2-6-10(8)13-11-7-3-5-9(11)12/h1-2,4,6H,3,5,7H2,(H,13,14) |
InChiKey: | InChIKey=XVCUDDRLBYJVEU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.