* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 5473804 |
| English Synonyms: | EMOLECULES 5473804 |
| MDL Number.: | MFCD02081802 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | Cc1ccc2c(c1)c(ncn2)NC(CC(=O)O)C(=O)O.Cl |
| InChi: | InChI=1S/C13H13N3O4.ClH/c1-7-2-3-9-8(4-7)12(15-6-14-9)16-10(13(19)20)5-11(17)18;/h2-4,6,10H,5H2,1H3,(H,17,18)(H,19,20)(H,14,15,16);1H |
| InChiKey: | InChIKey=JPOVRNICSICSQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.