* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL (E)-2-ACETYL-5-PHENYL-4-PENTENOATE |
| CAS: | 108400-97-1 |
| English Synonyms: | ETHYL (E)-2-ACETYL-5-PHENYL-4-PENTENOATE |
| MDL Number.: | MFCD02082720 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C(C/C=C/c1ccccc1)C(=O)C |
| InChi: | InChI=1S/C15H18O3/c1-3-18-15(17)14(12(2)16)11-7-10-13-8-5-4-6-9-13/h4-10,14H,3,11H2,1-2H3/b10-7+ |
| InChiKey: | InChIKey=CWQNCOQPLICNMH-JXMROGBWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.