* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-([2-(4-PROPOXYPHENOXY)ETHYL]THIO)-9H-PURIN-6-AMINE |
| English Synonyms: | 8-([2-(4-PROPOXYPHENOXY)ETHYL]THIO)-9H-PURIN-6-AMINE |
| MDL Number.: | MFCD02086709 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | C(CC)OC1=CC=C(OCCSC=2NC3=NC=NC(=C3N2)N)C=C1 |
| InChi: | InChI=1S/C16H19N5O2S/c1-2-7-22-11-3-5-12(6-4-11)23-8-9-24-16-20-13-14(17)18-10-19-15(13)21-16/h3-6,10H,2,7-9H2,1H3,(H3,17,18,19,20,21) |
| InChiKey: | InChIKey=OQOSGPQPTMLHRP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.