* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 5-OCT-1-YNYLNICOTINATE |
| English Synonyms: | ETHYL 5-OCT-1-YNYLNICOTINATE |
| MDL Number.: | MFCD02089792 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCCCCCC#Cc1cc(cnc1)C(=O)OCC |
| InChi: | InChI=1S/C16H21NO2/c1-3-5-6-7-8-9-10-14-11-15(13-17-12-14)16(18)19-4-2/h11-13H,3-8H2,1-2H3 |
| InChiKey: | InChIKey=MRRHJAMBKSGEOL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.