* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GASTRIN (1-6), HUMAN |
| English Synonyms: | GASTRIN (1-6), HUMAN |
| MDL Number.: | MFCD02093352 |
| H bond acceptor: | 17 |
| H bond donor: | 8 |
| Smile: | CC(C)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)NC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)[C@@H]3CCCN3C(=O)CNC(=O)[C@@H]4CCC(=O)N4 |
| InChi: | InChI=1S/C34H45N7O10/c1-18(2)14-24(31(47)38-23(34(50)51)10-12-29(44)45)39-32(48)25(15-19-16-35-21-7-4-3-6-20(19)21)40-33(49)26-8-5-13-41(26)28(43)17-36-30(46)22-9-11-27(42)37-22/h3-4,6-7,16,18,22-26,35H,5,8-15,17H2,1-2H3,(H,36,46)(H,37,42)(H,38,47)(H,39,48)(H,40,49)(H,44,45)(H,50,51)/t22-,23-,24-,25-,26-/m0/s1 |
| InChiKey: | InChIKey=COQMBLSZXBAHPB-LROMGURASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.