* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035991 |
English Synonyms: | VITAS-BB TBB035991 |
MDL Number.: | MFCD02104980 |
H bond acceptor: | 9 |
H bond donor: | 0 |
Smile: | COC(=O)C1=CN(CC2=CC=C(OC)C=C2)C=C(C1C1=CC(OC)=C(OC)C(OC)=C1)C(=O)OC |
InChi: | InChI=1S/C26H29NO8/c1-30-18-9-7-16(8-10-18)13-27-14-19(25(28)34-5)23(20(15-27)26(29)35-6)17-11-21(31-2)24(33-4)22(12-17)32-3/h7-12,14-15,23H,13H2,1-6H3 |
InChiKey: | InChIKey=SPEKGEVPBVXKMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.