* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036000 |
| English Synonyms: | VITAS-BB TBB036000 |
| MDL Number.: | MFCD02104997 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | COC(=O)C1=CN(CC2=CC=CC=C2)C=C(C1C1=CC(OC)=C(OC)C(OC)=C1)C(=O)OC |
| InChi: | InChI=1S/C25H27NO7/c1-29-20-11-17(12-21(30-2)23(20)31-3)22-18(24(27)32-4)14-26(15-19(22)25(28)33-5)13-16-9-7-6-8-10-16/h6-12,14-15,22H,13H2,1-5H3 |
| InChiKey: | InChIKey=QBGLQLKLSKZRQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.