* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 1862698 |
English Synonyms: | EMOLECULES 1862698 |
MDL Number.: | MFCD02105146 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1ccc2c(c1)c(ncn2)NCCCCCC(=O)O.Cl |
InChi: | InChI=1S/C15H19N3O2.ClH/c1-11-6-7-13-12(9-11)15(18-10-17-13)16-8-4-2-3-5-14(19)20;/h6-7,9-10H,2-5,8H2,1H3,(H,19,20)(H,16,17,18);1H |
InChiKey: | InChIKey=OOJYIHATCXSPAA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.