* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036032 |
| English Synonyms: | VITAS-BB TBB036032 |
| MDL Number.: | MFCD02105329 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | COC(=O)C1=CN(CC2=CC=CS2)C=C(C1C1=CC2=C(OCO2)C=C1)C(=O)OC |
| InChi: | InChI=1S/C21H19NO6S/c1-25-20(23)15-10-22(9-14-4-3-7-29-14)11-16(21(24)26-2)19(15)13-5-6-17-18(8-13)28-12-27-17/h3-8,10-11,19H,9,12H2,1-2H3 |
| InChiKey: | InChIKey=PWPJZIAHYYQKQB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.