* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036036 |
| English Synonyms: | VITAS-BB TBB036036 |
| MDL Number.: | MFCD02105343 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | COC(=O)C1=CN(CC2=CC=C(F)C=C2)C=C(C1C1=CC=C(C=C1)C(F)(F)F)C(=O)OC |
| InChi: | InChI=1S/C23H19F4NO4/c1-31-21(29)18-12-28(11-14-3-9-17(24)10-4-14)13-19(22(30)32-2)20(18)15-5-7-16(8-6-15)23(25,26)27/h3-10,12-13,20H,11H2,1-2H3 |
| InChiKey: | InChIKey=CVLVHBWNCFQNAI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.