* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB035852 |
English Synonyms: | VITAS-BB TBB035852 |
MDL Number.: | MFCD02105418 |
H bond acceptor: | 10 |
H bond donor: | 3 |
Smile: | CCOC1=C(O)C(=CC(=C1)C1NC(=O)NC(C)=C1C(=O)OC(C)C)[N+]([O-])=O |
InChi: | InChI=1S/C17H21N3O7/c1-5-26-12-7-10(6-11(15(12)21)20(24)25)14-13(16(22)27-8(2)3)9(4)18-17(23)19-14/h6-8,14,21H,5H2,1-4H3,(H2,18,19,23) |
InChiKey: | InChIKey=IPUHVMKVNHLPHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.