* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035838 |
| English Synonyms: | VITAS-BB TBB035838 |
| MDL Number.: | MFCD02105420 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCCCCOC(=O)C1=C(C)NC(=O)NC1C1=CC(Br)=CC=C1OC |
| InChi: | InChI=1S/C18H23BrN2O4/c1-4-5-6-9-25-17(22)15-11(2)20-18(23)21-16(15)13-10-12(19)7-8-14(13)24-3/h7-8,10,16H,4-6,9H2,1-3H3,(H2,20,21,23) |
| InChiKey: | InChIKey=UNDAJJBVNJQNKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.