* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 42770316 |
English Synonyms: | EMOLECULES 42770316 |
MDL Number.: | MFCD02108071 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(ccc1COCC(CN2CCCCC2)O)Cl.Cl |
InChi: | InChI=1S/C15H22ClNO2.ClH/c16-14-6-4-13(5-7-14)11-19-12-15(18)10-17-8-2-1-3-9-17;/h4-7,15,18H,1-3,8-12H2;1H |
InChiKey: | InChIKey=VCIQMVZHMOSKHJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.