* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB000211 |
English Synonyms: | ZERENEX ZX006855 ; VITAS-BB TBB000211 |
MDL Number.: | MFCD02127970 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | ClC1=CC=CC=C1C1OC2(C3C1C(=O)N(C1CCCCC1)C3=O)C(=O)C1=C(C=CC=C1)C2=O |
InChi: | InChI=1S/C26H22ClNO5/c27-18-13-7-6-12-17(18)21-19-20(25(32)28(24(19)31)14-8-2-1-3-9-14)26(33-21)22(29)15-10-4-5-11-16(15)23(26)30/h4-7,10-14,19-21H,1-3,8-9H2 |
InChiKey: | InChIKey=GHYDESYCDKDWSC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.