* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023941 |
English Synonyms: | VITAS-BB TBB023941 |
MDL Number.: | MFCD02156190 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COC1=CC(OC)=C(OC)C=C1\C=N\NC(=O)C1=CC=C2C=CC=CC2=C1O |
InChi: | InChI=1S/C21H20N2O5/c1-26-17-11-19(28-3)18(27-2)10-14(17)12-22-23-21(25)16-9-8-13-6-4-5-7-15(13)20(16)24/h4-12,24H,1-3H3,(H,23,25)/b22-12+ |
InChiKey: | InChIKey=VJFFSDLRKROZAL-WSDLNYQXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.