* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-BENZYLADENINE |
| CAS: | 7280-81-1 |
| English Synonyms: | 3-BENZYLADENINE ; 3-BENZYL-3H-PURIN-6-AMINE |
| MDL Number.: | MFCD02167626 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)Cn2cnc(c-3ncnc23)N |
| InChi: | InChI=1S/C12H11N5/c13-11-10-12(15-7-14-10)17(8-16-11)6-9-4-2-1-3-5-9/h1-5,7-8H,6,13H2 |
| InChiKey: | InChIKey=ZRRXJVVXTVXDII-UHFFFAOYSA-N |
|
|
| Melting Point: | 268-275 DEG C |
| Comments: | UNSPSC: 12352100 WGK: 3 |
|
|
| Symbol: |
GHS05
GHS07
|
| Signal word: | Danger |
| Hazard statements: | H302-H315-H318-H335 |
| Precautionary statements: | P261-P280-P305 + P351 + P338 |
| hazard symbol: | Xn |
| Risk Code: | R:22-37/38-41 |
| Safe Code: | S:26-36/37/39 |
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.