* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 26654267 |
| English Synonyms: | EMOLECULES 26654267 |
| MDL Number.: | MFCD02170460 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[n+]1c2ccccc2sc1/C=C/Nc3ccccc3.[Cl-] |
| InChi: | InChI=1S/C16H14N2S.ClH/c1-18-14-9-5-6-10-15(14)19-16(18)11-12-17-13-7-3-2-4-8-13;/h2-12H,1H3;1H |
| InChiKey: | InChIKey=XVCLHRATMTYJAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.