* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024384 |
| English Synonyms: | VITAS-BB TBB024384 |
| MDL Number.: | MFCD02174051 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCCCCCCCCNC(=O)C1=C2C=CC=CC2=NC(=C1)C1=CC=C(OCC)C=C1 |
| InChi: | InChI=1S/C28H36N2O2/c1-3-5-6-7-8-9-10-13-20-29-28(31)25-21-27(30-26-15-12-11-14-24(25)26)22-16-18-23(19-17-22)32-4-2/h11-12,14-19,21H,3-10,13,20H2,1-2H3,(H,29,31) |
| InChiKey: | InChIKey=GFKYPIICHSNPGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.