* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020784 |
English Synonyms: | VITAS-BB TBB020784 |
MDL Number.: | MFCD02175932 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COC(=O)C1=C(NC(=O)CCCC2=CC=CC=C2)SC=C1C1=CC=C(C=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C28H25NO3S/c1-32-28(31)26-24(23-17-15-22(16-18-23)21-12-6-3-7-13-21)19-33-27(26)29-25(30)14-8-11-20-9-4-2-5-10-20/h2-7,9-10,12-13,15-19H,8,11,14H2,1H3,(H,29,30) |
InChiKey: | InChIKey=WIXXSWAEVVSOJP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.