* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021103 |
English Synonyms: | VITAS-BB TBB021103 |
MDL Number.: | MFCD02176009 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC1CCC2=C(C1)SC(NC(=O)C1=C(C)OC(C)=C1)=C2C(N)=O |
InChi: | InChI=1S/C17H20N2O3S/c1-8-4-5-11-13(6-8)23-17(14(11)15(18)20)19-16(21)12-7-9(2)22-10(12)3/h7-8H,4-6H2,1-3H3,(H2,18,20)(H,19,21) |
InChiKey: | InChIKey=VMIPKVCEGFEHSH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.