* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB022045 |
| English Synonyms: | VITAS-BB TBB022045 |
| MDL Number.: | MFCD02176066 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCCOC1=CC=CC(=C1)C1=CC(C(=O)NC2=C(C(=O)OC)C3=C(CCCC3)S2)=C2C=CC=CC2=N1 |
| InChi: | InChI=1S/C29H28N2O4S/c1-3-15-35-19-10-8-9-18(16-19)24-17-22(20-11-4-6-13-23(20)30-24)27(32)31-28-26(29(33)34-2)21-12-5-7-14-25(21)36-28/h4,6,8-11,13,16-17H,3,5,7,12,14-15H2,1-2H3,(H,31,32) |
| InChiKey: | InChIKey=YGHDQHSIVRHAJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.